C10H16N2OS — CID 115891364
2-[1-(1,3-thiazol-4-yl)ethylamino]cyclopentan-1-ol (PubChem CID 115891364) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is 2-[1-(1,3-thiazol-4-yl)ethylamino]cyclopentan-1-ol.
| Compound Name | 2-[1-(1,3-thiazol-4-yl)ethylamino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 115891364 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2-[1-(1,3-thiazol-4-yl)ethylamino]cyclopentan-1-ol |
| SMILES | CC(NC1CCCC1O)c1cscn1 |
| InChI | InChI=1S/C10H16N2OS/c1-7(9-5-14-6-11-9)12-8-3-2-4-10(8)13/h5-8,10,12-13H,2-4H2,1H3 |
| InChIKey | MLCLGNRCOSENTH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |