C13H20N2O — CID 102731505
trans-(1S,2S)-2-[[(1R)-1-pyridin-2-ylethyl]amino]cyclohexan-1-ol (PubChem CID 102731505) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is trans-(1S,2S)-2-[[(1R)-1-pyridin-2-ylethyl]amino]cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-[[(1R)-1-pyridin-2-ylethyl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 102731505 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | trans-(1S,2S)-2-[[(1R)-1-pyridin-2-ylethyl]amino]cyclohexan-1-ol |
| SMILES | C[C@@H](N[C@H]1CCCC[C@@H]1O)c1ccccn1 |
| InChI | InChI=1S/C13H20N2O/c1-10(11-6-4-5-9-14-11)15-12-7-2-3-8-13(12)16/h4-6,9-10,12-13,15-16H,2-3,7-8H2,1H3/t10-,12+,13+/m1/s1 |
| InChIKey | GSBJMSNAVFJQTI-WXHSDQCUSA-N |
| XLogP | 2.04 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |