C14H23N3 — CID 81402190
2-(aminomethyl)-N-[(1R)-1-pyridin-2-ylethyl]cyclohexan-1-amine (PubChem CID 81402190) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[(1R)-1-pyridin-2-ylethyl]cyclohexan-1-amine.
| Compound Name | 2-(aminomethyl)-N-[(1R)-1-pyridin-2-ylethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 81402190 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 2-(aminomethyl)-N-[(1R)-1-pyridin-2-ylethyl]cyclohexan-1-amine |
| SMILES | C[C@@H](NC1CCCCC1CN)c1ccccn1 |
| InChI | InChI=1S/C14H23N3/c1-11(13-7-4-5-9-16-13)17-14-8-3-2-6-12(14)10-15/h4-5,7,9,11-12,14,17H,2-3,6,8,10,15H2,1H3/t11-,12?,14?/m1/s1 |
| InChIKey | DQTGHNJQYARDHW-LKSINWNRSA-N |
| XLogP | 2.25 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |