About [4-[1-(1,3-thiazol-4-yl)ethylamino]cyclohexyl]methanol
[4-[1-(1,3-thiazol-4-yl)ethylamino]cyclohexyl]methanol (PubChem CID 103881440) has the molecular formula C12H20N2OS
and a molecular weight of 240.37 g/mol. Its IUPAC name is [4-[1-(1,3-thiazol-4-yl)ethylamino]cyclohexyl]methanol.
Molecular Properties
| Compound Name | [4-[1-(1,3-thiazol-4-yl)ethylamino]cyclohexyl]methanol |
| PubChem CID | 103881440 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | [4-[1-(1,3-thiazol-4-yl)ethylamino]cyclohexyl]methanol |
| SMILES | CC(NC1CCC(CO)CC1)c1cscn1 |
| InChI | InChI=1S/C12H20N2OS/c1-9(12-7-16-8-13-12)14-11-4-2-10(6-15)3-5-11/h7-11,14-15H,2-6H2,1H3 |
| InChIKey | PLXOZLYKJMNVAO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[1-(1,3-thiazol-4-yl)ethylamino]cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[1-(1,3-thiazol-4-yl)ethylamino]cyclohexyl]methanol?
The IUPAC name of [4-[1-(1,3-thiazol-4-yl)ethylamino]cyclohexyl]methanol (CID 103881440) is [4-[1-(1,3-thiazol-4-yl)ethylamino]cyclohexyl]methanol.
What is the SMILES notation for [4-[1-(1,3-thiazol-4-yl)ethylamino]cyclohexyl]methanol?
The canonical SMILES for [4-[1-(1,3-thiazol-4-yl)ethylamino]cyclohexyl]methanol is CC(NC1CCC(CO)CC1)c1cscn1.
What is the InChIKey of [4-[1-(1,3-thiazol-4-yl)ethylamino]cyclohexyl]methanol?
The InChIKey is PLXOZLYKJMNVAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2OS/c1-9(12-7-16-8-13-12)14-11-4-2-10(6-15)3-5-11/h7-11,14-15H,2-6H2,1H3.
What are the key properties of [4-[1-(1,3-thiazol-4-yl)ethylamino]cyclohexyl]methanol?
[4-[1-(1,3-thiazol-4-yl)ethylamino]cyclohexyl]methanol has a molecular weight of 240.37 g/mol, XLogP of 2.34, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[1-(1,3-thiazol-4-yl)ethylamino]cyclohexyl]methanol is sourced from PubChem (CID 103881440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).