C12H19N3O3S — CID 105329744
[2-(1,1-dioxothiolan-3-yl)-1-(5-methoxy-3-pyridinyl)ethyl]hydrazine (PubChem CID 105329744) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is [2-(1,1-dioxothiolan-3-yl)-1-(5-methoxy-3-pyridinyl)ethyl]hydrazine.
| Compound Name | [2-(1,1-dioxothiolan-3-yl)-1-(5-methoxy-3-pyridinyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105329744 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | [2-(1,1-dioxothiolan-3-yl)-1-(5-methoxy-3-pyridinyl)ethyl]hydrazine |
| SMILES | COc1cncc(C(CC2CCS(=O)(=O)C2)NN)c1 |
| InChI | InChI=1S/C12H19N3O3S/c1-18-11-5-10(6-14-7-11)12(15-13)4-9-2-3-19(16,17)8-9/h5-7,9,12,15H,2-4,8,13H2,1H3 |
| InChIKey | AZGXAAKSSOUIHF-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|