C13H26N2O2S — CID 105330653
[1-cycloheptyl-2-(1,1-dioxothiolan-3-yl)ethyl]hydrazine (PubChem CID 105330653) has the molecular formula C13H26N2O2S and a molecular weight of 274.43 g/mol. Its IUPAC name is [1-cycloheptyl-2-(1,1-dioxothiolan-3-yl)ethyl]hydrazine.
| Compound Name | [1-cycloheptyl-2-(1,1-dioxothiolan-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105330653 |
| Molecular Formula | C13H26N2O2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | [1-cycloheptyl-2-(1,1-dioxothiolan-3-yl)ethyl]hydrazine |
| SMILES | NNC(CC1CCS(=O)(=O)C1)C1CCCCCC1 |
| InChI | InChI=1S/C13H26N2O2S/c14-15-13(12-5-3-1-2-4-6-12)9-11-7-8-18(16,17)10-11/h11-13,15H,1-10,14H2 |
| InChIKey | HGFXREVHCJQHAE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|