C13H20N2O2S — CID 105283106
[1-(1,1-dioxothiolan-3-yl)-3-phenylpropan-2-yl]hydrazine (PubChem CID 105283106) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is [1-(1,1-dioxothiolan-3-yl)-3-phenylpropan-2-yl]hydrazine.
| Compound Name | [1-(1,1-dioxothiolan-3-yl)-3-phenylpropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105283106 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | [1-(1,1-dioxothiolan-3-yl)-3-phenylpropan-2-yl]hydrazine |
| SMILES | NNC(Cc1ccccc1)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H20N2O2S/c14-15-13(8-11-4-2-1-3-5-11)9-12-6-7-18(16,17)10-12/h1-5,12-13,15H,6-10,14H2 |
| InChIKey | AEGDBCGMHLVPRD-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|