C17H23N3 — CID 105223956
2-[1-hydrazinyl-2-(2,4,6-trimethylphenyl)ethyl]aniline (PubChem CID 105223956) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is 2-[1-hydrazinyl-2-(2,4,6-trimethylphenyl)ethyl]aniline.
| Compound Name | 2-[1-hydrazinyl-2-(2,4,6-trimethylphenyl)ethyl]aniline |
|---|---|
| PubChem CID | 105223956 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 2-[1-hydrazinyl-2-(2,4,6-trimethylphenyl)ethyl]aniline |
| SMILES | Cc1cc(C)c(CC(NN)c2ccccc2N)c(C)c1 |
| InChI | InChI=1S/C17H23N3/c1-11-8-12(2)15(13(3)9-11)10-17(20-19)14-6-4-5-7-16(14)18/h4-9,17,20H,10,18-19H2,1-3H3 |
| InChIKey | LQOXTDKTLRUHND-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|