C18H23ClN2 — CID 105292752
[1-(2-chloro-3-methylphenyl)-2-(2,4,6-trimethylphenyl)ethyl]hydrazine (PubChem CID 105292752) has the molecular formula C18H23ClN2 and a molecular weight of 302.85 g/mol. Its IUPAC name is [1-(2-chloro-3-methylphenyl)-2-(2,4,6-trimethylphenyl)ethyl]hydrazine.
| Compound Name | [1-(2-chloro-3-methylphenyl)-2-(2,4,6-trimethylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105292752 |
| Molecular Formula | C18H23ClN2 |
| Molecular Weight | 302.85 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | [1-(2-chloro-3-methylphenyl)-2-(2,4,6-trimethylphenyl)ethyl]hydrazine |
| SMILES | Cc1cc(C)c(CC(NN)c2cccc(C)c2Cl)c(C)c1 |
| InChI | InChI=1S/C18H23ClN2/c1-11-8-13(3)16(14(4)9-11)10-17(21-20)15-7-5-6-12(2)18(15)19/h5-9,17,21H,10,20H2,1-4H3 |
| InChIKey | XTYAYGLIXTZUDJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.85 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|