C17H29N3S — CID 105326738
[1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]hydrazine (PubChem CID 105326738) has the molecular formula C17H29N3S and a molecular weight of 307.51 g/mol. Its IUPAC name is [1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]hydrazine.
| Compound Name | [1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105326738 |
| Molecular Formula | C17H29N3S |
| Molecular Weight | 307.51 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | [1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]hydrazine |
| SMILES | Cc1nc(CC(NN)C2CCC3CCCCC3C2)sc1C |
| InChI | InChI=1S/C17H29N3S/c1-11-12(2)21-17(19-11)10-16(20-18)15-8-7-13-5-3-4-6-14(13)9-15/h13-16,20H,3-10,18H2,1-2H3 |
| InChIKey | GEBSXEJCLYBGQU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|