C13H26N4S — CID 105240949
N,N-diethyl-2-hydrazinyl-3-methyl-1-(1,3-thiazol-2-yl)pentan-3-amine (PubChem CID 105240949) has the molecular formula C13H26N4S and a molecular weight of 270.45 g/mol. Its IUPAC name is N,N-diethyl-2-hydrazinyl-3-methyl-1-(1,3-thiazol-2-yl)pentan-3-amine.
| Compound Name | N,N-diethyl-2-hydrazinyl-3-methyl-1-(1,3-thiazol-2-yl)pentan-3-amine |
|---|---|
| PubChem CID | 105240949 |
| Molecular Formula | C13H26N4S |
| Molecular Weight | 270.45 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | N,N-diethyl-2-hydrazinyl-3-methyl-1-(1,3-thiazol-2-yl)pentan-3-amine |
| SMILES | CCN(CC)C(C)(CC)C(Cc1nccs1)NN |
| InChI | InChI=1S/C13H26N4S/c1-5-13(4,17(6-2)7-3)11(16-14)10-12-15-8-9-18-12/h8-9,11,16H,5-7,10,14H2,1-4H3 |
| InChIKey | SOFOWPJZLGHIAV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|