C10H19N3OS — CID 105324590
[4-propoxy-1-(1,3-thiazol-2-yl)butan-2-yl]hydrazine (PubChem CID 105324590) has the molecular formula C10H19N3OS and a molecular weight of 229.35 g/mol. Its IUPAC name is [4-propoxy-1-(1,3-thiazol-2-yl)butan-2-yl]hydrazine.
| Compound Name | [4-propoxy-1-(1,3-thiazol-2-yl)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105324590 |
| Molecular Formula | C10H19N3OS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | [4-propoxy-1-(1,3-thiazol-2-yl)butan-2-yl]hydrazine |
| SMILES | CCCOCCC(Cc1nccs1)NN |
| InChI | InChI=1S/C10H19N3OS/c1-2-5-14-6-3-9(13-11)8-10-12-4-7-15-10/h4,7,9,13H,2-3,5-6,8,11H2,1H3 |
| InChIKey | QFYQGQPFNMEHIP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|