C18H34N2S — CID 63416762
1-(4-methyl-1,3-thiazol-2-yl)-N-propylundecan-2-amine (PubChem CID 63416762) has the molecular formula C18H34N2S and a molecular weight of 310.55 g/mol. Its IUPAC name is 1-(4-methyl-1,3-thiazol-2-yl)-N-propylundecan-2-amine.
| Compound Name | 1-(4-methyl-1,3-thiazol-2-yl)-N-propylundecan-2-amine |
|---|---|
| PubChem CID | 63416762 |
| Molecular Formula | C18H34N2S |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | 1-(4-methyl-1,3-thiazol-2-yl)-N-propylundecan-2-amine |
| SMILES | CCCCCCCCCC(Cc1nc(C)cs1)NCCC |
| InChI | InChI=1S/C18H34N2S/c1-4-6-7-8-9-10-11-12-17(19-13-5-2)14-18-20-16(3)15-21-18/h15,17,19H,4-14H2,1-3H3 |
| InChIKey | XVLMSNACGZUCHI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|