C13H20N2S — CID 63644001
1-(4-methyl-1,3-thiazol-2-yl)-N-propylhex-5-yn-2-amine (PubChem CID 63644001) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is 1-(4-methyl-1,3-thiazol-2-yl)-N-propylhex-5-yn-2-amine.
| Compound Name | 1-(4-methyl-1,3-thiazol-2-yl)-N-propylhex-5-yn-2-amine |
|---|---|
| PubChem CID | 63644001 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 1-(4-methyl-1,3-thiazol-2-yl)-N-propylhex-5-yn-2-amine |
| SMILES | C#CCCC(Cc1nc(C)cs1)NCCC |
| InChI | InChI=1S/C13H20N2S/c1-4-6-7-12(14-8-5-2)9-13-15-11(3)10-16-13/h1,10,12,14H,5-9H2,2-3H3 |
| InChIKey | BSSNNIFCJCBGJM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|