C13H18N2S2 — CID 105169161
N-propyl-1-(1,3-thiazol-2-yl)-3-thiophen-3-ylpropan-2-amine (PubChem CID 105169161) has the molecular formula C13H18N2S2 and a molecular weight of 266.43 g/mol. Its IUPAC name is N-propyl-1-(1,3-thiazol-2-yl)-3-thiophen-3-ylpropan-2-amine.
| Compound Name | N-propyl-1-(1,3-thiazol-2-yl)-3-thiophen-3-ylpropan-2-amine |
|---|---|
| PubChem CID | 105169161 |
| Molecular Formula | C13H18N2S2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | N-propyl-1-(1,3-thiazol-2-yl)-3-thiophen-3-ylpropan-2-amine |
| SMILES | CCCNC(Cc1ccsc1)Cc1nccs1 |
| InChI | InChI=1S/C13H18N2S2/c1-2-4-14-12(8-11-3-6-16-10-11)9-13-15-5-7-17-13/h3,5-7,10,12,14H,2,4,8-9H2,1H3 |
| InChIKey | ZCGIXEBQKXYAMA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |