C14H18BrNS2 — CID 105139513
1-(3-bromothiophen-2-yl)-N-propyl-3-thiophen-3-ylpropan-2-amine (PubChem CID 105139513) has the molecular formula C14H18BrNS2 and a molecular weight of 344.34 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)-N-propyl-3-thiophen-3-ylpropan-2-amine.
| Compound Name | 1-(3-bromothiophen-2-yl)-N-propyl-3-thiophen-3-ylpropan-2-amine |
|---|---|
| PubChem CID | 105139513 |
| Molecular Formula | C14H18BrNS2 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)-N-propyl-3-thiophen-3-ylpropan-2-amine |
| SMILES | CCCNC(Cc1ccsc1)Cc1sccc1Br |
| InChI | InChI=1S/C14H18BrNS2/c1-2-5-16-12(8-11-3-6-17-10-11)9-14-13(15)4-7-18-14/h3-4,6-7,10,12,16H,2,5,8-9H2,1H3 |
| InChIKey | QCDNFGFHPJJLAC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |