C18H24BrNS — CID 105139445
1-(3-bromothiophen-2-yl)-5-phenyl-N-propylpentan-2-amine (PubChem CID 105139445) has the molecular formula C18H24BrNS and a molecular weight of 366.37 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)-5-phenyl-N-propylpentan-2-amine.
| Compound Name | 1-(3-bromothiophen-2-yl)-5-phenyl-N-propylpentan-2-amine |
|---|---|
| PubChem CID | 105139445 |
| Molecular Formula | C18H24BrNS |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)-5-phenyl-N-propylpentan-2-amine |
| SMILES | CCCNC(CCCc1ccccc1)Cc1sccc1Br |
| InChI | InChI=1S/C18H24BrNS/c1-2-12-20-16(14-18-17(19)11-13-21-18)10-6-9-15-7-4-3-5-8-15/h3-5,7-8,11,13,16,20H,2,6,9-10,12,14H2,1H3 |
| InChIKey | STBKJTHKKIWLQY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |