C15H20BrNOS — CID 105139656
1-(3-bromothiophen-2-yl)-4-(furan-2-yl)-N-propylbutan-2-amine (PubChem CID 105139656) has the molecular formula C15H20BrNOS and a molecular weight of 342.30 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)-4-(furan-2-yl)-N-propylbutan-2-amine.
| Compound Name | 1-(3-bromothiophen-2-yl)-4-(furan-2-yl)-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 105139656 |
| Molecular Formula | C15H20BrNOS |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)-4-(furan-2-yl)-N-propylbutan-2-amine |
| SMILES | CCCNC(CCc1ccco1)Cc1sccc1Br |
| InChI | InChI=1S/C15H20BrNOS/c1-2-8-17-12(5-6-13-4-3-9-18-13)11-15-14(16)7-10-19-15/h3-4,7,9-10,12,17H,2,5-6,8,11H2,1H3 |
| InChIKey | CHGKIOHFIJWBAC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |