C14H24BrNO2S — CID 102928573
1-(3-bromothiophen-2-yl)-4-(2-methoxyethoxy)-N-propylbutan-2-amine (PubChem CID 102928573) has the molecular formula C14H24BrNO2S and a molecular weight of 350.32 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)-4-(2-methoxyethoxy)-N-propylbutan-2-amine.
| Compound Name | 1-(3-bromothiophen-2-yl)-4-(2-methoxyethoxy)-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 102928573 |
| Molecular Formula | C14H24BrNO2S |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)-4-(2-methoxyethoxy)-N-propylbutan-2-amine |
| SMILES | CCCNC(CCOCCOC)Cc1sccc1Br |
| InChI | InChI=1S/C14H24BrNO2S/c1-3-6-16-12(4-7-18-9-8-17-2)11-14-13(15)5-10-19-14/h5,10,12,16H,3-4,6-9,11H2,1-2H3 |
| InChIKey | NHERBOCMJCPHOY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|