C14H20N2OS — CID 105169314
4-(furan-2-yl)-N-propyl-1-(1,3-thiazol-2-yl)butan-2-amine (PubChem CID 105169314) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is 4-(furan-2-yl)-N-propyl-1-(1,3-thiazol-2-yl)butan-2-amine.
| Compound Name | 4-(furan-2-yl)-N-propyl-1-(1,3-thiazol-2-yl)butan-2-amine |
|---|---|
| PubChem CID | 105169314 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 4-(furan-2-yl)-N-propyl-1-(1,3-thiazol-2-yl)butan-2-amine |
| SMILES | CCCNC(CCc1ccco1)Cc1nccs1 |
| InChI | InChI=1S/C14H20N2OS/c1-2-7-15-12(11-14-16-8-10-18-14)5-6-13-4-3-9-17-13/h3-4,8-10,12,15H,2,5-7,11H2,1H3 |
| InChIKey | GWIFEUKJMBGOOY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |