C14H31NO2S — CID 115865137
1-ethylsulfonyl-6,8,8-trimethylnonan-4-amine (PubChem CID 115865137) has the molecular formula C14H31NO2S and a molecular weight of 277.47 g/mol. Its IUPAC name is 1-ethylsulfonyl-6,8,8-trimethylnonan-4-amine.
| Compound Name | 1-ethylsulfonyl-6,8,8-trimethylnonan-4-amine |
|---|---|
| PubChem CID | 115865137 |
| Molecular Formula | C14H31NO2S |
| Molecular Weight | 277.47 g/mol |
| Exact Mass | 277.21 |
| IUPAC Name | 1-ethylsulfonyl-6,8,8-trimethylnonan-4-amine |
| SMILES | CCS(=O)(=O)CCCC(N)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C14H31NO2S/c1-6-18(16,17)9-7-8-13(15)10-12(2)11-14(3,4)5/h12-13H,6-11,15H2,1-5H3 |
| InChIKey | MEVGGRGEBCZPRN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |