C14H31N — CID 115846063
3,7,9,9-tetramethyldecan-5-amine (PubChem CID 115846063) has the molecular formula C14H31N and a molecular weight of 213.41 g/mol. Its IUPAC name is 3,7,9,9-tetramethyldecan-5-amine.
| Compound Name | 3,7,9,9-tetramethyldecan-5-amine |
|---|---|
| PubChem CID | 115846063 |
| Molecular Formula | C14H31N |
| Molecular Weight | 213.41 g/mol |
| Exact Mass | 213.25 |
| IUPAC Name | 3,7,9,9-tetramethyldecan-5-amine |
| SMILES | CCC(C)CC(N)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C14H31N/c1-7-11(2)8-13(15)9-12(3)10-14(4,5)6/h11-13H,7-10,15H2,1-6H3 |
| InChIKey | ZIPFILUMLFXUCY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |