C12H24F3N — CID 104992603
1,1,1-trifluoro-6,8,8-trimethylnonan-4-amine (PubChem CID 104992603) has the molecular formula C12H24F3N and a molecular weight of 239.32 g/mol. Its IUPAC name is 1,1,1-trifluoro-6,8,8-trimethylnonan-4-amine.
| Compound Name | 1,1,1-trifluoro-6,8,8-trimethylnonan-4-amine |
|---|---|
| PubChem CID | 104992603 |
| Molecular Formula | C12H24F3N |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 1,1,1-trifluoro-6,8,8-trimethylnonan-4-amine |
| SMILES | CC(CC(N)CCC(F)(F)F)CC(C)(C)C |
| InChI | InChI=1S/C12H24F3N/c1-9(8-11(2,3)4)7-10(16)5-6-12(13,14)15/h9-10H,5-8,16H2,1-4H3 |
| InChIKey | RNHUXJACXWOFJR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |