C31H66P+ — CID 59676416
tributyl-[5,7,7-trimethyl-2-(2,4,4-trimethylpentyl)octyl]phosphanium (PubChem CID 59676416) has the molecular formula C31H66P+ and a molecular weight of 469.84 g/mol. Its IUPAC name is tributyl-[5,7,7-trimethyl-2-(2,4,4-trimethylpentyl)octyl]phosphanium.
| Compound Name | tributyl-[5,7,7-trimethyl-2-(2,4,4-trimethylpentyl)octyl]phosphanium |
|---|---|
| PubChem CID | 59676416 |
| Molecular Formula | C31H66P+ |
| Molecular Weight | 469.84 g/mol |
| Exact Mass | 469.49 |
| IUPAC Name | tributyl-[5,7,7-trimethyl-2-(2,4,4-trimethylpentyl)octyl]phosphanium |
| SMILES | CCCC[P+](CCCC)(CCCC)CC(CCC(C)CC(C)(C)C)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C31H66P/c1-12-15-20-32(21-16-13-2,22-17-14-3)26-29(23-28(5)25-31(9,10)11)19-18-27(4)24-30(6,7)8/h27-29H,12-26H2,1-11H3/q+1 |
| InChIKey | JLZKLSFHGTYTMC-UHFFFAOYSA-N |
| XLogP | 11.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.84 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|