C38H78O2 — CID 151128370
2,2,4-trimethyl-7-(2,2,4-trimethylhexadecan-7-ylperoxy)hexadecane (PubChem CID 151128370) has the molecular formula C38H78O2 and a molecular weight of 567.04 g/mol. Its IUPAC name is 2,2,4-trimethyl-7-(2,2,4-trimethylhexadecan-7-ylperoxy)hexadecane.
| Compound Name | 2,2,4-trimethyl-7-(2,2,4-trimethylhexadecan-7-ylperoxy)hexadecane |
|---|---|
| PubChem CID | 151128370 |
| Molecular Formula | C38H78O2 |
| Molecular Weight | 567.04 g/mol |
| Exact Mass | 566.60 |
| IUPAC Name | 2,2,4-trimethyl-7-(2,2,4-trimethylhexadecan-7-ylperoxy)hexadecane |
| SMILES | CCCCCCCCCC(CCC(C)CC(C)(C)C)OOC(CCCCCCCCC)CCC(C)CC(C)(C)C |
| InChI | InChI=1S/C38H78O2/c1-11-13-15-17-19-21-23-25-35(29-27-33(3)31-37(5,6)7)39-40-36(26-24-22-20-18-16-14-12-2)30-28-34(4)32-38(8,9)10/h33-36H,11-32H2,1-10H3 |
| InChIKey | MTRFZMXTTQSHGM-UHFFFAOYSA-N |
| XLogP | 13.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.04 |
| LogP ≤ 5 | 13.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|