C24H48O2 — CID 91716891
pentadecan-6-yl 3,5,5-trimethylhexanoate (PubChem CID 91716891) has the molecular formula C24H48O2 and a molecular weight of 368.65 g/mol. Its IUPAC name is pentadecan-6-yl 3,5,5-trimethylhexanoate.
| Compound Name | pentadecan-6-yl 3,5,5-trimethylhexanoate |
|---|---|
| PubChem CID | 91716891 |
| Molecular Formula | C24H48O2 |
| Molecular Weight | 368.65 g/mol |
| Exact Mass | 368.37 |
| IUPAC Name | pentadecan-6-yl 3,5,5-trimethylhexanoate |
| SMILES | CCCCCCCCCC(CCCCC)OC(=O)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C24H48O2/c1-7-9-11-12-13-14-16-18-22(17-15-10-8-2)26-23(25)19-21(3)20-24(4,5)6/h21-22H,7-20H2,1-6H3 |
| InChIKey | UUGYDVZTQYAHMP-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.65 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|