C15H34OSi — CID 175226380
2,2-dimethyltridecan-4-yloxysilane (PubChem CID 175226380) has the molecular formula C15H34OSi and a molecular weight of 258.52 g/mol. Its IUPAC name is 2,2-dimethyltridecan-4-yloxysilane.
| Compound Name | 2,2-dimethyltridecan-4-yloxysilane |
|---|---|
| PubChem CID | 175226380 |
| Molecular Formula | C15H34OSi |
| Molecular Weight | 258.52 g/mol |
| Exact Mass | 258.24 |
| IUPAC Name | 2,2-dimethyltridecan-4-yloxysilane |
| SMILES | CCCCCCCCCC(CC(C)(C)C)O[SiH3] |
| InChI | InChI=1S/C15H34OSi/c1-5-6-7-8-9-10-11-12-14(16-17)13-15(2,3)4/h14H,5-13H2,1-4,17H3 |
| InChIKey | KRMRFNKQNFSRKN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|