About tetradecan-2-yloxysilane
tetradecan-2-yloxysilane (PubChem CID 173015270) has the molecular formula C14H32OSi
and a molecular weight of 244.49 g/mol. Its IUPAC name is tetradecan-2-yloxysilane.
Molecular Properties
| Compound Name | tetradecan-2-yloxysilane |
| PubChem CID | 173015270 |
| Molecular Formula | C14H32OSi |
| Molecular Weight | 244.49 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | tetradecan-2-yloxysilane |
| SMILES | CCCCCCCCCCCCC(C)O[SiH3] |
| InChI | InChI=1S/C14H32OSi/c1-3-4-5-6-7-8-9-10-11-12-13-14(2)15-16/h14H,3-13H2,1-2,16H3 |
| InChIKey | JBXAQCWRLOQBBF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tetradecan-2-yloxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetradecan-2-yloxysilane?
The IUPAC name of tetradecan-2-yloxysilane (CID 173015270) is tetradecan-2-yloxysilane.
What is the SMILES notation for tetradecan-2-yloxysilane?
The canonical SMILES for tetradecan-2-yloxysilane is CCCCCCCCCCCCC(C)O[SiH3].
What is the InChIKey of tetradecan-2-yloxysilane?
The InChIKey is JBXAQCWRLOQBBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32OSi/c1-3-4-5-6-7-8-9-10-11-12-13-14(2)15-16/h14H,3-13H2,1-2,16H3.
What are the key properties of tetradecan-2-yloxysilane?
tetradecan-2-yloxysilane has a molecular weight of 244.49 g/mol, XLogP of 3.98, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tetradecan-2-yloxysilane is sourced from PubChem (CID 173015270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).