About di(decan-2-yloxy)silane
di(decan-2-yloxy)silane (PubChem CID 123195552) has the molecular formula C20H44O2Si
and a molecular weight of 344.66 g/mol. Its IUPAC name is di(decan-2-yloxy)silane.
Molecular Properties
| Compound Name | di(decan-2-yloxy)silane |
| PubChem CID | 123195552 |
| Molecular Formula | C20H44O2Si |
| Molecular Weight | 344.66 g/mol |
| Exact Mass | 344.31 |
| IUPAC Name | di(decan-2-yloxy)silane |
| SMILES | CCCCCCCCC(C)O[SiH2]OC(C)CCCCCCCC |
| InChI | InChI=1S/C20H44O2Si/c1-5-7-9-11-13-15-17-19(3)21-23-22-20(4)18-16-14-12-10-8-6-2/h19-20H,5-18,23H2,1-4H3 |
| InChIKey | PEMUSAAYNZBZAB-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.66 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze di(decan-2-yloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(decan-2-yloxy)silane?
The IUPAC name of di(decan-2-yloxy)silane (CID 123195552) is di(decan-2-yloxy)silane.
What is the SMILES notation for di(decan-2-yloxy)silane?
The canonical SMILES for di(decan-2-yloxy)silane is CCCCCCCCC(C)O[SiH2]OC(C)CCCCCCCC.
What is the InChIKey of di(decan-2-yloxy)silane?
The InChIKey is PEMUSAAYNZBZAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H44O2Si/c1-5-7-9-11-13-15-17-19(3)21-23-22-20(4)18-16-14-12-10-8-6-2/h19-20H,5-18,23H2,1-4H3.
What are the key properties of di(decan-2-yloxy)silane?
di(decan-2-yloxy)silane has a molecular weight of 344.66 g/mol, XLogP of 6.30, 18 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for di(decan-2-yloxy)silane is sourced from PubChem (CID 123195552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).