About bis[(2R)-octan-2-yl] [(2S)-octan-2-yl] borate
bis[(2R)-octan-2-yl] [(2S)-octan-2-yl] borate (PubChem CID 99771040) has the molecular formula C24H51BO3
and a molecular weight of 398.48 g/mol. Its IUPAC name is bis[(2R)-octan-2-yl] [(2S)-octan-2-yl] borate.
Molecular Properties
| Compound Name | bis[(2R)-octan-2-yl] [(2S)-octan-2-yl] borate |
| PubChem CID | 99771040 |
| Molecular Formula | C24H51BO3 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.39 |
| IUPAC Name | bis[(2R)-octan-2-yl] [(2S)-octan-2-yl] borate |
| SMILES | CCCCCC[C@@H](C)OB(O[C@H](C)CCCCCC)O[C@@H](C)CCCCCC |
| InChI | InChI=1S/C24H51BO3/c1-7-10-13-16-19-22(4)26-25(27-23(5)20-17-14-11-8-2)28-24(6)21-18-15-12-9-3/h22-24H,7-21H2,1-6H3/t22-,23-,24+/m1/s1 |
| InChIKey | CNZRYPUWXCLTAW-SMIHKQSGSA-N |
| XLogP | 8.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis[(2R)-octan-2-yl] [(2S)-octan-2-yl] borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(2R)-octan-2-yl] [(2S)-octan-2-yl] borate?
The IUPAC name of bis[(2R)-octan-2-yl] [(2S)-octan-2-yl] borate (CID 99771040) is bis[(2R)-octan-2-yl] [(2S)-octan-2-yl] borate.
What is the SMILES notation for bis[(2R)-octan-2-yl] [(2S)-octan-2-yl] borate?
The canonical SMILES for bis[(2R)-octan-2-yl] [(2S)-octan-2-yl] borate is CCCCCC[C@@H](C)OB(O[C@H](C)CCCCCC)O[C@@H](C)CCCCCC.
What is the InChIKey of bis[(2R)-octan-2-yl] [(2S)-octan-2-yl] borate?
The InChIKey is CNZRYPUWXCLTAW-SMIHKQSGSA-N. The full InChI is InChI=1S/C24H51BO3/c1-7-10-13-16-19-22(4)26-25(27-23(5)20-17-14-11-8-2)28-24(6)21-18-15-12-9-3/h22-24H,7-21H2,1-6H3/t22-,23-,24+/m1/s1.
What are the key properties of bis[(2R)-octan-2-yl] [(2S)-octan-2-yl] borate?
bis[(2R)-octan-2-yl] [(2S)-octan-2-yl] borate has a molecular weight of 398.48 g/mol, XLogP of 8.10, 21 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(2R)-octan-2-yl] [(2S)-octan-2-yl] borate is sourced from PubChem (CID 99771040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).