About octan-2-yl dioctan-2-yloxy borate
octan-2-yl dioctan-2-yloxy borate (PubChem CID 141414381) has the molecular formula C24H51BO5
and a molecular weight of 430.48 g/mol. Its IUPAC name is octan-2-yl dioctan-2-yloxy borate.
Molecular Properties
| Compound Name | octan-2-yl dioctan-2-yloxy borate |
| PubChem CID | 141414381 |
| Molecular Formula | C24H51BO5 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.38 |
| IUPAC Name | octan-2-yl dioctan-2-yloxy borate |
| SMILES | CCCCCCC(C)OOB(OOC(C)CCCCCC)OC(C)CCCCCC |
| InChI | InChI=1S/C24H51BO5/c1-7-10-13-16-19-22(4)26-25(29-27-23(5)20-17-14-11-8-2)30-28-24(6)21-18-15-12-9-3/h22-24H,7-21H2,1-6H3 |
| InChIKey | MTILQTQUGGHHLL-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze octan-2-yl dioctan-2-yloxy borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octan-2-yl dioctan-2-yloxy borate?
The IUPAC name of octan-2-yl dioctan-2-yloxy borate (CID 141414381) is octan-2-yl dioctan-2-yloxy borate.
What is the SMILES notation for octan-2-yl dioctan-2-yloxy borate?
The canonical SMILES for octan-2-yl dioctan-2-yloxy borate is CCCCCCC(C)OOB(OOC(C)CCCCCC)OC(C)CCCCCC.
What is the InChIKey of octan-2-yl dioctan-2-yloxy borate?
The InChIKey is MTILQTQUGGHHLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H51BO5/c1-7-10-13-16-19-22(4)26-25(29-27-23(5)20-17-14-11-8-2)30-28-24(6)21-18-15-12-9-3/h22-24H,7-21H2,1-6H3.
What are the key properties of octan-2-yl dioctan-2-yloxy borate?
octan-2-yl dioctan-2-yloxy borate has a molecular weight of 430.48 g/mol, XLogP of 7.96, 23 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for octan-2-yl dioctan-2-yloxy borate is sourced from PubChem (CID 141414381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).