About 2-(trioxidanyl)undecane
2-(trioxidanyl)undecane (PubChem CID 140733486) has the molecular formula C11H24O3
and a molecular weight of 204.31 g/mol. Its IUPAC name is 2-(trioxidanyl)undecane.
Molecular Properties
| Compound Name | 2-(trioxidanyl)undecane |
| PubChem CID | 140733486 |
| Molecular Formula | C11H24O3 |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | 2-(trioxidanyl)undecane |
| SMILES | CCCCCCCCCC(C)OOO |
| InChI | InChI=1S/C11H24O3/c1-3-4-5-6-7-8-9-10-11(2)13-14-12/h11-12H,3-10H2,1-2H3 |
| InChIKey | AQZMOBZFGVASQE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-(trioxidanyl)undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trioxidanyl)undecane?
The IUPAC name of 2-(trioxidanyl)undecane (CID 140733486) is 2-(trioxidanyl)undecane.
What is the SMILES notation for 2-(trioxidanyl)undecane?
The canonical SMILES for 2-(trioxidanyl)undecane is CCCCCCCCCC(C)OOO.
What is the InChIKey of 2-(trioxidanyl)undecane?
The InChIKey is AQZMOBZFGVASQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O3/c1-3-4-5-6-7-8-9-10-11(2)13-14-12/h11-12H,3-10H2,1-2H3.
What are the key properties of 2-(trioxidanyl)undecane?
2-(trioxidanyl)undecane has a molecular weight of 204.31 g/mol, XLogP of 3.94, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trioxidanyl)undecane is sourced from PubChem (CID 140733486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).