About hexan-2-yloxyboronic acid
hexan-2-yloxyboronic acid (PubChem CID 159771152) has the molecular formula C6H15BO3
and a molecular weight of 146.00 g/mol. Its IUPAC name is hexan-2-yloxyboronic acid.
Molecular Properties
| Compound Name | hexan-2-yloxyboronic acid |
| PubChem CID | 159771152 |
| Molecular Formula | C6H15BO3 |
| Molecular Weight | 146.00 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | hexan-2-yloxyboronic acid |
| SMILES | CCCCC(C)OB(O)O |
| InChI | InChI=1S/C6H15BO3/c1-3-4-5-6(2)10-7(8)9/h6,8-9H,3-5H2,1-2H3 |
| InChIKey | NEFQECKMNUGIDL-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.00 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze hexan-2-yloxyboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-2-yloxyboronic acid?
The IUPAC name of hexan-2-yloxyboronic acid (CID 159771152) is hexan-2-yloxyboronic acid.
What is the SMILES notation for hexan-2-yloxyboronic acid?
The canonical SMILES for hexan-2-yloxyboronic acid is CCCCC(C)OB(O)O.
What is the InChIKey of hexan-2-yloxyboronic acid?
The InChIKey is NEFQECKMNUGIDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15BO3/c1-3-4-5-6(2)10-7(8)9/h6,8-9H,3-5H2,1-2H3.
What are the key properties of hexan-2-yloxyboronic acid?
hexan-2-yloxyboronic acid has a molecular weight of 146.00 g/mol, XLogP of 0.55, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-2-yloxyboronic acid is sourced from PubChem (CID 159771152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).