C27H57N — CID 150267312
N-(2-ethylhexyl)-N-(3,5,5-trimethylhexyl)decan-1-amine (PubChem CID 150267312) has the molecular formula C27H57N and a molecular weight of 395.76 g/mol. Its IUPAC name is N-(2-ethylhexyl)-N-(3,5,5-trimethylhexyl)decan-1-amine.
| Compound Name | N-(2-ethylhexyl)-N-(3,5,5-trimethylhexyl)decan-1-amine |
|---|---|
| PubChem CID | 150267312 |
| Molecular Formula | C27H57N |
| Molecular Weight | 395.76 g/mol |
| Exact Mass | 395.45 |
| IUPAC Name | N-(2-ethylhexyl)-N-(3,5,5-trimethylhexyl)decan-1-amine |
| SMILES | CCCCCCCCCCN(CCC(C)CC(C)(C)C)CC(CC)CCCC |
| InChI | InChI=1S/C27H57N/c1-8-11-13-14-15-16-17-18-21-28(24-26(10-3)19-12-9-2)22-20-25(4)23-27(5,6)7/h25-26H,8-24H2,1-7H3 |
| InChIKey | GCURFZHINSOEFJ-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.76 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|