About ethylperoxyethane;3-methylheptane
ethylperoxyethane;3-methylheptane (PubChem CID 161352622) has the molecular formula C12H28O2
and a molecular weight of 204.35 g/mol. Its IUPAC name is ethylperoxyethane;3-methylheptane.
Molecular Properties
| Compound Name | ethylperoxyethane;3-methylheptane |
| PubChem CID | 161352622 |
| Molecular Formula | C12H28O2 |
| Molecular Weight | 204.35 g/mol |
| Exact Mass | 204.21 |
| IUPAC Name | ethylperoxyethane;3-methylheptane |
| SMILES | CCCCC(C)CC.CCOOCC |
| InChI | InChI=1S/C8H18.C4H10O2/c1-4-6-7-8(3)5-2;1-3-5-6-4-2/h8H,4-7H2,1-3H3;3-4H2,1-2H3 |
| InChIKey | VOCSQMIQXZKNFD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze ethylperoxyethane;3-methylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylperoxyethane;3-methylheptane?
The IUPAC name of ethylperoxyethane;3-methylheptane (CID 161352622) is ethylperoxyethane;3-methylheptane.
What is the SMILES notation for ethylperoxyethane;3-methylheptane?
The canonical SMILES for ethylperoxyethane;3-methylheptane is CCCCC(C)CC.CCOOCC.
What is the InChIKey of ethylperoxyethane;3-methylheptane?
The InChIKey is VOCSQMIQXZKNFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.C4H10O2/c1-4-6-7-8(3)5-2;1-3-5-6-4-2/h8H,4-7H2,1-3H3;3-4H2,1-2H3.
What are the key properties of ethylperoxyethane;3-methylheptane?
ethylperoxyethane;3-methylheptane has a molecular weight of 204.35 g/mol, XLogP of 4.20, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethylperoxyethane;3-methylheptane is sourced from PubChem (CID 161352622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).