C12H26S6 — CID 19809261
2,7-dimethyl-2,7-bis(sulfanylmethyl)octane-1,4,5,8-tetrathiol (PubChem CID 19809261) has the molecular formula C12H26S6 and a molecular weight of 362.74 g/mol. Its IUPAC name is 2,7-dimethyl-2,7-bis(sulfanylmethyl)octane-1,4,5,8-tetrathiol.
| Compound Name | 2,7-dimethyl-2,7-bis(sulfanylmethyl)octane-1,4,5,8-tetrathiol |
|---|---|
| PubChem CID | 19809261 |
| Molecular Formula | C12H26S6 |
| Molecular Weight | 362.74 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 2,7-dimethyl-2,7-bis(sulfanylmethyl)octane-1,4,5,8-tetrathiol |
| SMILES | CC(CS)(CS)CC(S)C(S)CC(C)(CS)CS |
| InChI | InChI=1S/C12H26S6/c1-11(5-13,6-14)3-9(17)10(18)4-12(2,7-15)8-16/h9-10,13-18H,3-8H2,1-2H3 |
| InChIKey | LTOMMFCFKUHSQZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.74 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|