C13H26S — CID 167200037
(E,5S)-3,4,5,7,7-pentamethyloct-3-ene-2-thiol (PubChem CID 167200037) has the molecular formula C13H26S and a molecular weight of 214.42 g/mol. Its IUPAC name is (E,5S)-3,4,5,7,7-pentamethyloct-3-ene-2-thiol.
| Compound Name | (E,5S)-3,4,5,7,7-pentamethyloct-3-ene-2-thiol |
|---|---|
| PubChem CID | 167200037 |
| Molecular Formula | C13H26S |
| Molecular Weight | 214.42 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | (E,5S)-3,4,5,7,7-pentamethyloct-3-ene-2-thiol |
| SMILES | C/C(=C(/C)[C@@H](C)CC(C)(C)C)C(C)S |
| InChI | InChI=1S/C13H26S/c1-9(8-13(5,6)7)10(2)11(3)12(4)14/h9,12,14H,8H2,1-7H3/b11-10+/t9-,12?/m0/s1 |
| InChIKey | DLTJCRUICDYZKJ-UMRNJYTFSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|