C15H31N — CID 105005536
2,5,7,7-tetramethyl-N-propyloct-1-en-3-amine (PubChem CID 105005536) has the molecular formula C15H31N and a molecular weight of 225.42 g/mol. Its IUPAC name is 2,5,7,7-tetramethyl-N-propyloct-1-en-3-amine.
| Compound Name | 2,5,7,7-tetramethyl-N-propyloct-1-en-3-amine |
|---|---|
| PubChem CID | 105005536 |
| Molecular Formula | C15H31N |
| Molecular Weight | 225.42 g/mol |
| Exact Mass | 225.25 |
| IUPAC Name | 2,5,7,7-tetramethyl-N-propyloct-1-en-3-amine |
| SMILES | C=C(C)C(CC(C)CC(C)(C)C)NCCC |
| InChI | InChI=1S/C15H31N/c1-8-9-16-14(12(2)3)10-13(4)11-15(5,6)7/h13-14,16H,2,8-11H2,1,3-7H3 |
| InChIKey | CSGYJMUKKYZZJZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|