C23H46N2O — CID 142054922
N-tert-butyl-1-iminobutan-2-amine;ethane;(2E,4E,6Z,8E)-5-methoxydeca-2,4,6,8-tetraene (PubChem CID 142054922) has the molecular formula C23H46N2O and a molecular weight of 366.63 g/mol. Its IUPAC name is N-tert-butyl-1-iminobutan-2-amine;ethane;(2E,4E,6Z,8E)-5-methoxydeca-2,4,6,8-tetraene.
| Compound Name | N-tert-butyl-1-iminobutan-2-amine;ethane;(2E,4E,6Z,8E)-5-methoxydeca-2,4,6,8-tetraene |
|---|---|
| PubChem CID | 142054922 |
| Molecular Formula | C23H46N2O |
| Molecular Weight | 366.63 g/mol |
| Exact Mass | 366.36 |
| IUPAC Name | N-tert-butyl-1-iminobutan-2-amine;ethane;(2E,4E,6Z,8E)-5-methoxydeca-2,4,6,8-tetraene |
| SMILES | C/C=C/C=C\C(=C/C=C/C)OC.CC.CC.[H]/N=C/C(CC)NC(C)(C)C |
| InChI | InChI=1S/C11H16O.C8H18N2.2C2H6/c1-4-6-8-10-11(12-3)9-7-5-2;1-5-7(6-9)10-8(2,3)4;2*1-2/h4-10H,1-3H3;6-7,9-10H,5H2,1-4H3;2*1-2H3/b6-4+,7-5+,10-8-,11-9+;9-6+;; |
| InChIKey | PVPPLCCWCYHRDQ-CPHLESEBSA-N |
| XLogP | 7.08 |
| TPSA | 45.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.63 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|