About 2-[[(2E)-hexa-2,4-dienoyl]amino]-3-methoxy-2-methylpropanoic acid
2-[[(2E)-hexa-2,4-dienoyl]amino]-3-methoxy-2-methylpropanoic acid (PubChem CID 103925883) has the molecular formula C11H17NO4
and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-[[(2E)-hexa-2,4-dienoyl]amino]-3-methoxy-2-methylpropanoic acid.
Molecular Properties
| Compound Name | 2-[[(2E)-hexa-2,4-dienoyl]amino]-3-methoxy-2-methylpropanoic acid |
| PubChem CID | 103925883 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2-[[(2E)-hexa-2,4-dienoyl]amino]-3-methoxy-2-methylpropanoic acid |
| SMILES | CC=C/C=C/C(=O)NC(C)(COC)C(=O)O |
| InChI | InChI=1S/C11H17NO4/c1-4-5-6-7-9(13)12-11(2,8-16-3)10(14)15/h4-7H,8H2,1-3H3,(H,12,13)(H,14,15)/b5-4?,7-6+ |
| InChIKey | OAFLRBIBBWYGTG-VFABXPAXSA-N |
| XLogP | 0.72 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(2E)-hexa-2,4-dienoyl]amino]-3-methoxy-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2E)-hexa-2,4-dienoyl]amino]-3-methoxy-2-methylpropanoic acid?
The IUPAC name of 2-[[(2E)-hexa-2,4-dienoyl]amino]-3-methoxy-2-methylpropanoic acid (CID 103925883) is 2-[[(2E)-hexa-2,4-dienoyl]amino]-3-methoxy-2-methylpropanoic acid.
What is the SMILES notation for 2-[[(2E)-hexa-2,4-dienoyl]amino]-3-methoxy-2-methylpropanoic acid?
The canonical SMILES for 2-[[(2E)-hexa-2,4-dienoyl]amino]-3-methoxy-2-methylpropanoic acid is CC=C/C=C/C(=O)NC(C)(COC)C(=O)O.
What is the InChIKey of 2-[[(2E)-hexa-2,4-dienoyl]amino]-3-methoxy-2-methylpropanoic acid?
The InChIKey is OAFLRBIBBWYGTG-VFABXPAXSA-N. The full InChI is InChI=1S/C11H17NO4/c1-4-5-6-7-9(13)12-11(2,8-16-3)10(14)15/h4-7H,8H2,1-3H3,(H,12,13)(H,14,15)/b5-4?,7-6+.
What are the key properties of 2-[[(2E)-hexa-2,4-dienoyl]amino]-3-methoxy-2-methylpropanoic acid?
2-[[(2E)-hexa-2,4-dienoyl]amino]-3-methoxy-2-methylpropanoic acid has a molecular weight of 227.26 g/mol, XLogP of 0.72, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2E)-hexa-2,4-dienoyl]amino]-3-methoxy-2-methylpropanoic acid is sourced from PubChem (CID 103925883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).