C12H20N2O — CID 115282581
N-(1-amino-2-cyclopropylpropan-2-yl)hexa-2,4-dienamide (PubChem CID 115282581) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is N-(1-amino-2-cyclopropylpropan-2-yl)hexa-2,4-dienamide.
| Compound Name | N-(1-amino-2-cyclopropylpropan-2-yl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 115282581 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | N-(1-amino-2-cyclopropylpropan-2-yl)hexa-2,4-dienamide |
| SMILES | CC=CC=CC(=O)NC(C)(CN)C1CC1 |
| InChI | InChI=1S/C12H20N2O/c1-3-4-5-6-11(15)14-12(2,9-13)10-7-8-10/h3-6,10H,7-9,13H2,1-2H3,(H,14,15) |
| InChIKey | MMPNGJAWFMAWPY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|