C10H17NO2 — CID 110839216
(2E,4E)-N-(3-methoxypropyl)hexa-2,4-dienamide (PubChem CID 110839216) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (2E,4E)-N-(3-methoxypropyl)hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-(3-methoxypropyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 110839216 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (2E,4E)-N-(3-methoxypropyl)hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)NCCCOC |
| InChI | InChI=1S/C10H17NO2/c1-3-4-5-7-10(12)11-8-6-9-13-2/h3-5,7H,6,8-9H2,1-2H3,(H,11,12)/b4-3+,7-5+ |
| InChIKey | AZKGNHZDCWTJRB-BDWKERMESA-N |
| XLogP | 1.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|