C14H18N2O2 — CID 63238331
(2E,4E)-N-[2-(4-aminophenoxy)ethyl]hexa-2,4-dienamide (PubChem CID 63238331) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is (2E,4E)-N-[2-(4-aminophenoxy)ethyl]hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-[2-(4-aminophenoxy)ethyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 63238331 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | (2E,4E)-N-[2-(4-aminophenoxy)ethyl]hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)NCCOc1ccc(N)cc1 |
| InChI | InChI=1S/C14H18N2O2/c1-2-3-4-5-14(17)16-10-11-18-13-8-6-12(15)7-9-13/h2-9H,10-11,15H2,1H3,(H,16,17)/b3-2+,5-4+ |
| InChIKey | YLGFVUNAJBQZRI-MQQKCMAXSA-N |
| XLogP | 1.90 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|