About 2-(3,3-dimethylbutanoylamino)-3-methoxy-2-methylpropanoic acid
2-(3,3-dimethylbutanoylamino)-3-methoxy-2-methylpropanoic acid (PubChem CID 115910285) has the molecular formula C11H21NO4
and a molecular weight of 231.29 g/mol. Its IUPAC name is 2-(3,3-dimethylbutanoylamino)-3-methoxy-2-methylpropanoic acid.
Analyze 2-(3,3-dimethylbutanoylamino)-3-methoxy-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-dimethylbutanoylamino)-3-methoxy-2-methylpropanoic acid?
The IUPAC name of 2-(3,3-dimethylbutanoylamino)-3-methoxy-2-methylpropanoic acid (CID 115910285) is 2-(3,3-dimethylbutanoylamino)-3-methoxy-2-methylpropanoic acid.
What is the SMILES notation for 2-(3,3-dimethylbutanoylamino)-3-methoxy-2-methylpropanoic acid?
The canonical SMILES for 2-(3,3-dimethylbutanoylamino)-3-methoxy-2-methylpropanoic acid is COCC(C)(NC(=O)CC(C)(C)C)C(=O)O.
What is the InChIKey of 2-(3,3-dimethylbutanoylamino)-3-methoxy-2-methylpropanoic acid?
The InChIKey is JMUDFXZAJJBUFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO4/c1-10(2,3)6-8(13)12-11(4,7-16-5)9(14)15/h6-7H2,1-5H3,(H,12,13)(H,14,15).
What are the key properties of 2-(3,3-dimethylbutanoylamino)-3-methoxy-2-methylpropanoic acid?
2-(3,3-dimethylbutanoylamino)-3-methoxy-2-methylpropanoic acid has a molecular weight of 231.29 g/mol, XLogP of 1.03, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-dimethylbutanoylamino)-3-methoxy-2-methylpropanoic acid is sourced from PubChem (CID 115910285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).