C9H17NO5 — CID 115910312
2-[(2-ethoxyacetyl)amino]-3-methoxy-2-methylpropanoic acid (PubChem CID 115910312) has the molecular formula C9H17NO5 and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-[(2-ethoxyacetyl)amino]-3-methoxy-2-methylpropanoic acid.
| Compound Name | 2-[(2-ethoxyacetyl)amino]-3-methoxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 115910312 |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 2-[(2-ethoxyacetyl)amino]-3-methoxy-2-methylpropanoic acid |
| SMILES | CCOCC(=O)NC(C)(COC)C(=O)O |
| InChI | InChI=1S/C9H17NO5/c1-4-15-5-7(11)10-9(2,6-14-3)8(12)13/h4-6H2,1-3H3,(H,10,11)(H,12,13) |
| InChIKey | LDKJMUKSFAHIFA-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |