C11H18O2 — CID 143436311
(2Z,4E,6E)-5,7-dimethoxynona-2,4,6-triene (PubChem CID 143436311) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (2Z,4E,6E)-5,7-dimethoxynona-2,4,6-triene.
| Compound Name | (2Z,4E,6E)-5,7-dimethoxynona-2,4,6-triene |
|---|---|
| PubChem CID | 143436311 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (2Z,4E,6E)-5,7-dimethoxynona-2,4,6-triene |
| SMILES | C/C=C\C=C(/C=C(\CC)OC)OC |
| InChI | InChI=1S/C11H18O2/c1-5-7-8-11(13-4)9-10(6-2)12-3/h5,7-9H,6H2,1-4H3/b7-5-,10-9+,11-8+ |
| InChIKey | SGXWYWXZKVDLGC-FRTBPSNISA-N |
| XLogP | 3.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|