C9H15BrO2 — CID 166942881
(3Z,5E)-4-bromo-6-methoxyocta-3,5-dien-3-ol (PubChem CID 166942881) has the molecular formula C9H15BrO2 and a molecular weight of 235.12 g/mol. Its IUPAC name is (3Z,5E)-4-bromo-6-methoxyocta-3,5-dien-3-ol.
| Compound Name | (3Z,5E)-4-bromo-6-methoxyocta-3,5-dien-3-ol |
|---|---|
| PubChem CID | 166942881 |
| Molecular Formula | C9H15BrO2 |
| Molecular Weight | 235.12 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | (3Z,5E)-4-bromo-6-methoxyocta-3,5-dien-3-ol |
| SMILES | CC/C(O)=C(Br)\C=C(/CC)OC |
| InChI | InChI=1S/C9H15BrO2/c1-4-7(12-3)6-8(10)9(11)5-2/h6,11H,4-5H2,1-3H3/b7-6+,9-8- |
| InChIKey | WVUTYHBGUUTBGR-MUIOLIGRSA-N |
| XLogP | 3.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.12 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|