C9H17NO3S — CID 163806945
N-[(3E)-4-methoxyhexa-1,3-dien-2-yl]-N-methylmethanesulfonamide (PubChem CID 163806945) has the molecular formula C9H17NO3S and a molecular weight of 219.31 g/mol. Its IUPAC name is N-[(3E)-4-methoxyhexa-1,3-dien-2-yl]-N-methylmethanesulfonamide.
| Compound Name | N-[(3E)-4-methoxyhexa-1,3-dien-2-yl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 163806945 |
| Molecular Formula | C9H17NO3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | N-[(3E)-4-methoxyhexa-1,3-dien-2-yl]-N-methylmethanesulfonamide |
| SMILES | C=C(/C=C(\CC)OC)N(C)S(C)(=O)=O |
| InChI | InChI=1S/C9H17NO3S/c1-6-9(13-4)7-8(2)10(3)14(5,11)12/h7H,2,6H2,1,3-5H3/b9-7+ |
| InChIKey | NJVACTCCIACUEJ-VQHVLOKHSA-N |
| XLogP | 1.33 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|