C8H13BrO — CID 166942927
(3Z)-4-bromo-6-methylhepta-3,5-dien-3-ol (PubChem CID 166942927) has the molecular formula C8H13BrO and a molecular weight of 205.09 g/mol. Its IUPAC name is (3Z)-4-bromo-6-methylhepta-3,5-dien-3-ol.
| Compound Name | (3Z)-4-bromo-6-methylhepta-3,5-dien-3-ol |
|---|---|
| PubChem CID | 166942927 |
| Molecular Formula | C8H13BrO |
| Molecular Weight | 205.09 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | (3Z)-4-bromo-6-methylhepta-3,5-dien-3-ol |
| SMILES | CC/C(O)=C(/Br)C=C(C)C |
| InChI | InChI=1S/C8H13BrO/c1-4-8(10)7(9)5-6(2)3/h5,10H,4H2,1-3H3/b8-7- |
| InChIKey | INPXIPKTYKILEH-FPLPWBNLSA-N |
| XLogP | 3.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.09 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|