About (3Z)-4-bromo-6-methylhepta-3,5-dien-3-ol
(3Z)-4-bromo-6-methylhepta-3,5-dien-3-ol (PubChem CID 166942927) has the molecular formula C8H13BrO
and a molecular weight of 205.09 g/mol. Its IUPAC name is (3Z)-4-bromo-6-methylhepta-3,5-dien-3-ol.
Molecular Properties
| Compound Name | (3Z)-4-bromo-6-methylhepta-3,5-dien-3-ol |
| PubChem CID | 166942927 |
| Molecular Formula | C8H13BrO |
| Molecular Weight | 205.09 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | (3Z)-4-bromo-6-methylhepta-3,5-dien-3-ol |
| SMILES | CC/C(O)=C(/Br)C=C(C)C |
| InChI | InChI=1S/C8H13BrO/c1-4-8(10)7(9)5-6(2)3/h5,10H,4H2,1-3H3/b8-7- |
| InChIKey | INPXIPKTYKILEH-FPLPWBNLSA-N |
| XLogP | 3.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.09 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-4-bromo-6-methylhepta-3,5-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-4-bromo-6-methylhepta-3,5-dien-3-ol?
The IUPAC name of (3Z)-4-bromo-6-methylhepta-3,5-dien-3-ol (CID 166942927) is (3Z)-4-bromo-6-methylhepta-3,5-dien-3-ol.
What is the SMILES notation for (3Z)-4-bromo-6-methylhepta-3,5-dien-3-ol?
The canonical SMILES for (3Z)-4-bromo-6-methylhepta-3,5-dien-3-ol is CC/C(O)=C(/Br)C=C(C)C.
What is the InChIKey of (3Z)-4-bromo-6-methylhepta-3,5-dien-3-ol?
The InChIKey is INPXIPKTYKILEH-FPLPWBNLSA-N. The full InChI is InChI=1S/C8H13BrO/c1-4-8(10)7(9)5-6(2)3/h5,10H,4H2,1-3H3/b8-7-.
What are the key properties of (3Z)-4-bromo-6-methylhepta-3,5-dien-3-ol?
(3Z)-4-bromo-6-methylhepta-3,5-dien-3-ol has a molecular weight of 205.09 g/mol, XLogP of 3.53, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-4-bromo-6-methylhepta-3,5-dien-3-ol is sourced from PubChem (CID 166942927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).