C6H9BrO2 — CID 174097321
(2Z)-3-bromohexa-2,4-diene-2,5-diol (PubChem CID 174097321) has the molecular formula C6H9BrO2 and a molecular weight of 193.04 g/mol. Its IUPAC name is (2Z)-3-bromohexa-2,4-diene-2,5-diol.
| Compound Name | (2Z)-3-bromohexa-2,4-diene-2,5-diol |
|---|---|
| PubChem CID | 174097321 |
| Molecular Formula | C6H9BrO2 |
| Molecular Weight | 193.04 g/mol |
| Exact Mass | 191.98 |
| IUPAC Name | (2Z)-3-bromohexa-2,4-diene-2,5-diol |
| SMILES | CC(O)=C/C(Br)=C(\C)O |
| InChI | InChI=1S/C6H9BrO2/c1-4(8)3-6(7)5(2)9/h3,8-9H,1-2H3/b4-3?,6-5- |
| InChIKey | FFKGZXRATOZUDW-FHMHXFBPSA-N |
| XLogP | 2.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.04 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|